8. Machine Learning Basics#
Objectives#
Build binary classification models that predict activity/inactivity of small molecules against human aromatase using supervised learning methods.
Evaluate the performance of the developed models using performance measures.
1. Import bioactivity data from PubChem#
In this notebook, we will develop a prediction model for small molecule’s activity against human aromatase (https://pubchem.ncbi.nlm.nih.gov/protein/EAW77416), which is encoded by the CYP19A1 gene (https://pubchem.ncbi.nlm.nih.gov/gene/1588). The model will predict the activity of a molecule based on the structure of the molecule (represented with molecular fingerprints).
For model development, we will use the Tox21 bioassay data for human aromatase, archived in PubChem (https://pubchem.ncbi.nlm.nih.gov/bioassay/743139). The bioactivity data presented on this page can be downloaded by clicking the “Download” button available on this page and then read the data into a data frame. Alternatively, you can directly load the data into a data frame as shown in the cell below.
import pandas as pd
import numpy as np
url = 'https://pubchem.ncbi.nlm.nih.gov/assay/pcget.cgi?query=download&record_type=datatable&actvty=all&response_type=save&aid=743139'
df_raw = pd.read_csv(url)
df_raw.head(7)
| PUBCHEM_RESULT_TAG | PUBCHEM_SID | PUBCHEM_CID | PUBCHEM_EXT_DATASOURCE_SMILES | PUBCHEM_ACTIVITY_OUTCOME | PUBCHEM_ACTIVITY_SCORE | PUBCHEM_ACTIVITY_URL | PUBCHEM_ASSAYDATA_COMMENT | Activity Summary | Antagonist Activity | Antagonist Potency (uM) | Antagonist Efficacy (%) | Viability Activity | Viability Potency (uM) | Viability Efficacy (%) | Sample Source | |
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
| 0 | RESULT_TYPE | NaN | NaN | NaN | NaN | NaN | NaN | NaN | STRING | STRING | FLOAT | FLOAT | STRING | FLOAT | FLOAT | STRING |
| 1 | RESULT_DESCR | NaN | NaN | NaN | NaN | NaN | NaN | NaN | Type of compound activity based on both the ar... | Type of compound activity in the aromatase ant... | The concentration of sample yielding half-maxi... | Percent inhibition of aromatase. | Type of compound activity in the cell viabilit... | The concentration of sample yielding half-maxi... | Percent inhibition of cell viability. | Where sample was obtained. |
| 2 | RESULT_UNIT | NaN | NaN | NaN | NaN | NaN | NaN | NaN | NaN | NaN | MICROMOLAR | PERCENT | NaN | MICROMOLAR | PERCENT | NaN |
| 3 | 1 | 144203552.0 | 12850184.0 | C(C(=O)[C@H]([C@@H]([C@H](C(=O)[O-])O)O)O)O.C(... | Inactive | 0.0 | NaN | NaN | inactive | inactive | NaN | 0 | inactive | NaN | 0 | NCI |
| 4 | 2 | 144203553.0 | 89753.0 | C([C@H]([C@H]([C@@H]([C@H](C(=O)[O-])O)O)O)O)O... | Inactive | 0.0 | NaN | NaN | inactive | inactive | NaN | 0 | inactive | NaN | 0 | NCI |
| 5 | 3 | 144203554.0 | 9403.0 | C[C@]12CC[C@H]3[C@H]([C@@H]1CC[C@@H]2OC(=O)CCC... | Inactive | 0.0 | NaN | NaN | inactive | inactive | NaN | 0 | inactive | NaN | 0 | NCI |
| 6 | 4 | 144203555.0 | 13218779.0 | C[C@@]12CC[C@@H](C1(C)C)C[C@H]2OC(=O)CSC#N | Inactive | 0.0 | NaN | NaN | inactive | inactive | NaN | 0 | inactive | NaN | 0 | NCI |
Note: Lines 0-2 provide the descriptions for each column (data type, descriptions, units, etc). These rows need be removed.
df_raw = df_raw[3:]
df_raw.head(5)
| PUBCHEM_RESULT_TAG | PUBCHEM_SID | PUBCHEM_CID | PUBCHEM_EXT_DATASOURCE_SMILES | PUBCHEM_ACTIVITY_OUTCOME | PUBCHEM_ACTIVITY_SCORE | PUBCHEM_ACTIVITY_URL | PUBCHEM_ASSAYDATA_COMMENT | Activity Summary | Antagonist Activity | Antagonist Potency (uM) | Antagonist Efficacy (%) | Viability Activity | Viability Potency (uM) | Viability Efficacy (%) | Sample Source | |
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
| 3 | 1 | 144203552.0 | 12850184.0 | C(C(=O)[C@H]([C@@H]([C@H](C(=O)[O-])O)O)O)O.C(... | Inactive | 0.0 | NaN | NaN | inactive | inactive | NaN | 0 | inactive | NaN | 0 | NCI |
| 4 | 2 | 144203553.0 | 89753.0 | C([C@H]([C@H]([C@@H]([C@H](C(=O)[O-])O)O)O)O)O... | Inactive | 0.0 | NaN | NaN | inactive | inactive | NaN | 0 | inactive | NaN | 0 | NCI |
| 5 | 3 | 144203554.0 | 9403.0 | C[C@]12CC[C@H]3[C@H]([C@@H]1CC[C@@H]2OC(=O)CCC... | Inactive | 0.0 | NaN | NaN | inactive | inactive | NaN | 0 | inactive | NaN | 0 | NCI |
| 6 | 4 | 144203555.0 | 13218779.0 | C[C@@]12CC[C@@H](C1(C)C)C[C@H]2OC(=O)CSC#N | Inactive | 0.0 | NaN | NaN | inactive | inactive | NaN | 0 | inactive | NaN | 0 | NCI |
| 7 | 5 | 144203556.0 | 142766.0 | C1=CC=C(C(=C1)C(=O)O)O.C1=CC2=C(C(=C1)O)N=CC=C2 | Inconclusive | 25.0 | NaN | NaN | inconclusive antagonist (cytotoxic) | active antagonist | 15.5454 | -115.803 | active antagonist | 14.9601 | -76.8218 | NCI |
The column names in this data frame contain white spaces and special characters. For simplicity, let’s rename the columns (no spaces or special characters except for the “_” character.)
df_raw.columns
Index(['PUBCHEM_RESULT_TAG', 'PUBCHEM_SID', 'PUBCHEM_CID',
'PUBCHEM_EXT_DATASOURCE_SMILES', 'PUBCHEM_ACTIVITY_OUTCOME',
'PUBCHEM_ACTIVITY_SCORE', 'PUBCHEM_ACTIVITY_URL',
'PUBCHEM_ASSAYDATA_COMMENT', 'Activity Summary', 'Antagonist Activity',
'Antagonist Potency (uM)', 'Antagonist Efficacy (%)',
'Viability Activity', 'Viability Potency (uM)',
'Viability Efficacy (%)', 'Sample Source'],
dtype='object')
col_names_map = {'PUBCHEM_RESULT_TAG' : 'pc_result_tag',
'PUBCHEM_SID' : 'sid',
'PUBCHEM_CID' : 'cid',
'PUBCHEM_ACTIVITY_OUTCOME' : 'activity_outcome',
'PUBCHEM_ACTIVITY_SCORE' : 'activity_score',
'PUBCHEM_ACTIVITY_URL' : 'activity_url',
'PUBCHEM_ASSAYDATA_COMMENT' : 'assay_data_comment',
'Activity Summary' : 'activity_summary',
'Antagonist Activity' : 'antagonist_activity',
'Antagonist Potency (uM)' : 'antagonist_potency',
'Antagonist Efficacy (%)' : 'antagonist_efficacy',
'Viability Activity' : 'viability_activity',
'Viability Potency (uM)' : 'viability_potency',
'Viability Efficacy (%)' : 'viability_efficacy',
'Sample Source' : 'sample_source' }
df_raw = df_raw.rename(columns = col_names_map)
df_raw.columns
Index(['pc_result_tag', 'sid', 'cid', 'PUBCHEM_EXT_DATASOURCE_SMILES',
'activity_outcome', 'activity_score', 'activity_url',
'assay_data_comment', 'activity_summary', 'antagonist_activity',
'antagonist_potency', 'antagonist_efficacy', 'viability_activity',
'viability_potency', 'viability_efficacy', 'sample_source'],
dtype='object')
2. Check the number of compounds for each activity group#
First, we need to understand what our data look like. Especially, we are interested in the activity class of the tested compounds because we are developing a model that classifies small molecules according to their activities against the target. This information is available in the “activity_outcome” and “activity_summary” columns.
df_raw.groupby(['activity_outcome']).count()
| pc_result_tag | sid | cid | PUBCHEM_EXT_DATASOURCE_SMILES | activity_score | activity_url | assay_data_comment | activity_summary | antagonist_activity | antagonist_potency | antagonist_efficacy | viability_activity | viability_potency | viability_efficacy | sample_source | |
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
| activity_outcome | |||||||||||||||
| Active | 379 | 379 | 378 | 378 | 379 | 0 | 0 | 379 | 379 | 378 | 379 | 379 | 115 | 359 | 379 |
| Inactive | 7562 | 7562 | 7466 | 7466 | 7562 | 0 | 0 | 7562 | 7562 | 0 | 7562 | 7562 | 324 | 7449 | 7562 |
| Inconclusive | 2545 | 2545 | 2493 | 2493 | 2545 | 0 | 0 | 2545 | 2545 | 2111 | 2136 | 2545 | 1206 | 2450 | 2545 |
Based on the data in the activity_outcome column, there are 379 actives, 7562 inactives, and 2545 inconclusives.
df_raw.groupby(['activity_outcome','activity_summary']).count()
| pc_result_tag | sid | cid | PUBCHEM_EXT_DATASOURCE_SMILES | activity_score | activity_url | assay_data_comment | antagonist_activity | antagonist_potency | antagonist_efficacy | viability_activity | viability_potency | viability_efficacy | sample_source | ||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
| activity_outcome | activity_summary | ||||||||||||||
| Active | active antagonist | 379 | 379 | 378 | 378 | 379 | 0 | 0 | 379 | 378 | 379 | 379 | 115 | 359 | 379 |
| Inactive | inactive | 7562 | 7562 | 7466 | 7466 | 7562 | 0 | 0 | 7562 | 0 | 7562 | 7562 | 324 | 7449 | 7562 |
| Inconclusive | active agonist | 612 | 612 | 571 | 571 | 612 | 0 | 0 | 612 | 612 | 612 | 612 | 60 | 590 | 612 |
| inconclusive | 44 | 44 | 44 | 44 | 44 | 0 | 0 | 44 | 0 | 0 | 44 | 19 | 42 | 44 | |
| inconclusive agonist | 414 | 414 | 409 | 409 | 414 | 0 | 0 | 414 | 212 | 223 | 414 | 12 | 397 | 414 | |
| inconclusive agonist (cytotoxic) | 59 | 59 | 59 | 59 | 59 | 0 | 0 | 59 | 41 | 45 | 59 | 59 | 59 | 59 | |
| inconclusive antagonist | 367 | 367 | 364 | 364 | 367 | 0 | 0 | 367 | 227 | 230 | 367 | 8 | 313 | 367 | |
| inconclusive antagonist (cytotoxic) | 1049 | 1049 | 1046 | 1046 | 1049 | 0 | 0 | 1049 | 1019 | 1026 | 1049 | 1048 | 1049 | 1049 |
Now, we can see that, in the activity_summary column, the inconclusive compounds are further classified into subclasses, which include:
active agonist
inconclusive
inconclusive agonist
inconclusive antagonist
inconclusive agonist (cytotoxic)
inconclusive antagonist (cytotoxic)
As implied in the title of this assay record (https://pubchem.ncbi.nlm.nih.gov/bioassay/743139), this assay aims to identify aromatase inhibitors. Therefore, all active antagonists (in the activity summary column) were declared to be active compounds (in the activity outcome column).
On the other hand, the assay also identified 612 active agonists (in the activity summary column), and they are declared to be inconclusive (in the activity outcome column).
With that said, “inactive” compounds in this assay means those which are neither active agonists nor active antagonist.
It is important to understand that the criteria used for determining whether a compound is active or not in a given assay are selected by the data source who submitted that assay data to PubChem. For the purpose of this assignment (which aims to develop a binary classifier that tells if a molecule is active or inactive against the target), we should clarify what we mean by “active” and “inactive”.
active : any compounds that can change (either increase or decrease) the activity of the target. This is equivalent to either active antagonists or active agonists in the activity summary column.
inactive : any compounds that do not change the activity of the target. This is equivalent to inactive compounds in the activity summary column.
3. Select active/inactive compounds for model building#
Now we want to select only the active and inactive compounds from the data frame (that is, active agonists, active antagonists, and inactives based on the “activity summary” column).
df = df_raw[ (df_raw['activity_summary'] == 'active agonist' ) |
(df_raw['activity_summary'] == 'active antagonist' ) |
(df_raw['activity_summary'] == 'inactive' ) ]
len(df)
8553
print(len(df['sid'].unique()))
print(len(df['cid'].unique()))
8553
6858
Note that the number of CIDs is not the same as the number of SIDs. There are two important potential reasons for this observation.
First, not all substances (SIDs) in PubChem have associated compounds (CIDs) because some substances failed during structure standardization. [Remember that, in PubChem, substances are depositor-provided structures and compounds are unique structures extracted from substances through structure standardization.] Because our model will use structural information of molecules to predict their bioactivity, we need to remove substances without associated CIDs (i.e., no standardized structures).
Second, some compounds are associated with more than one substances. In the context of this assay, it means that a compound may be tested multiple times in different samples (which are designated as different substances). It is not uncommon that different samples of the same chemical may result in conflicting activities (e.g., active agonist in one sample but inactive in another sample). In this practice, we remove such compounds with conflicting activities.
3-(1) Drop substances without associated CIDs.#
First, check if there are subtances without associated CIDs.
df.isna().sum()
pc_result_tag 0
sid 0
cid 138
PUBCHEM_EXT_DATASOURCE_SMILES 138
activity_outcome 0
activity_score 0
activity_url 8553
assay_data_comment 8553
activity_summary 0
antagonist_activity 0
antagonist_potency 7563
antagonist_efficacy 0
viability_activity 0
viability_potency 8054
viability_efficacy 155
sample_source 0
dtype: int64
There are 138 records whose “cid” column is NULL, and we want to remove those records.
df = df.dropna( subset=['cid'] )
len(df)
8415
print(len(df['sid'].unique()))
print(len(df['cid'].unique()))
8415
6857
df.isna().sum() # Check if the NULL values disappeared in the "cid" column
pc_result_tag 0
sid 0
cid 0
PUBCHEM_EXT_DATASOURCE_SMILES 0
activity_outcome 0
activity_score 0
activity_url 8415
assay_data_comment 8415
activity_summary 0
antagonist_activity 0
antagonist_potency 7467
antagonist_efficacy 0
viability_activity 0
viability_potency 7919
viability_efficacy 154
sample_source 0
dtype: int64
3-(2) Remove CIDs with conflicting activities#
Now identify compounds with conflicting activities and remove them.
cid_conflict = []
idx_conflict = []
for mycid in df['cid'].unique() :
outcomes = df[ df.cid == mycid ].activity_summary.unique()
if len(outcomes) > 1 :
idx_tmp = df.index[ df.cid == mycid ].tolist()
idx_conflict.extend(idx_tmp)
cid_conflict.append(mycid)
print("#", len(cid_conflict), "CIDs with conflicting activities [associated with", len(idx_conflict), "rows (SIDs).]")
# 66 CIDs with conflicting activities [associated with 150 rows (SIDs).]
df.loc[idx_conflict,:].head(10)
| pc_result_tag | sid | cid | PUBCHEM_EXT_DATASOURCE_SMILES | activity_outcome | activity_score | activity_url | assay_data_comment | activity_summary | antagonist_activity | antagonist_potency | antagonist_efficacy | viability_activity | viability_potency | viability_efficacy | sample_source | |
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
| 8 | 6 | 144203557.0 | 16043.0 | CC(C)(C)C1=C(C=CC(=C1)O)O | Inactive | 0.0 | NaN | NaN | inactive | inactive | NaN | 0 | inactive | NaN | 0 | NCI |
| 5956 | 5954 | 144209507.0 | 16043.0 | CC(C)(C)C1=C(C=CC(=C1)O)O | Active | 43.0 | NaN | NaN | active antagonist | active antagonist | 54.4827 | -73.4024 | inconclusive antagonist | NaN | NaN | SigmaAldrich |
| 6850 | 6848 | 144210401.0 | 16043.0 | CC(C)(C)C1=C(C=CC(=C1)O)O | Inactive | 0.0 | NaN | NaN | inactive | inactive | NaN | 0 | inactive | NaN | 0 | SIGMA |
| 52 | 50 | 144203601.0 | 443939.0 | C[C@H]1[C@H]([C@H](C[C@@H](O1)O[C@H]2C[C@@](CC... | Inactive | 0.0 | NaN | NaN | inactive | inactive | NaN | 0 | inactive | NaN | 0 | NCI |
| 6130 | 6128 | 144209681.0 | 443939.0 | C[C@H]1[C@H]([C@H](C[C@@H](O1)O[C@H]2C[C@@](CC... | Active | 61.0 | NaN | NaN | active antagonist | active antagonist | 1.65519 | -115.932 | active antagonist | 12.1763 | -120.598 | Toronto Research |
| 66 | 64 | 144203615.0 | 2170.0 | C1CN(CCN1)C2=NC3=CC=CC=C3OC4=C2C=C(C=C4)Cl | Inactive | 0.0 | NaN | NaN | inactive | inactive | NaN | 0 | inactive | NaN | 0 | BIOMOL |
| 9118 | 9116 | 144212669.0 | 2170.0 | C1CN(CCN1)C2=NC3=CC=CC=C3OC4=C2C=C(C=C4)Cl | Active | 50.0 | NaN | NaN | active antagonist | active antagonist | 16.5803 | -115.202 | inconclusive antagonist | 61.1306 | -80.7706 | SIGMA |
| 106 | 104 | 144203655.0 | 2554.0 | C1=CC=C2C(=C1)C=CC3=CC=CC=C3N2C(=O)N | Inconclusive | 20.0 | NaN | NaN | active agonist | active agonist | 2.87255 | 73.7025 | inactive | NaN | 0 | SigmaAldrich |
| 5920 | 5918 | 144209471.0 | 2554.0 | C1=CC=C2C(=C1)C=CC3=CC=CC=C3N2C(=O)N | Inactive | 0.0 | NaN | NaN | inactive | inactive | NaN | 0 | inactive | NaN | 0 | SIGMA |
| 6964 | 6962 | 144210515.0 | 2554.0 | C1=CC=C2C(=C1)C=CC3=CC=CC=C3N2C(=O)N | Inactive | 0.0 | NaN | NaN | inactive | inactive | NaN | 0 | inactive | NaN | 0 | SIGMA |
df = df.drop(idx_conflict)
df.groupby('activity_summary').count()
| pc_result_tag | sid | cid | PUBCHEM_EXT_DATASOURCE_SMILES | activity_outcome | activity_score | activity_url | assay_data_comment | antagonist_activity | antagonist_potency | antagonist_efficacy | viability_activity | viability_potency | viability_efficacy | sample_source | |
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
| activity_summary | |||||||||||||||
| active agonist | 537 | 537 | 537 | 537 | 537 | 537 | 0 | 0 | 537 | 537 | 537 | 537 | 58 | 517 | 537 |
| active antagonist | 342 | 342 | 342 | 342 | 342 | 342 | 0 | 0 | 342 | 341 | 342 | 342 | 108 | 326 | 342 |
| inactive | 7386 | 7386 | 7386 | 7386 | 7386 | 7386 | 0 | 0 | 7386 | 0 | 7386 | 7386 | 318 | 7275 | 7386 |
print(len(df['sid'].unique()))
print(len(df['cid'].unique()))
8265
6791
3-(3) Remove redundant data#
The above code cells [in 3-(2)] do not remove compounds tested multiple times if the testing results are consistent [e.g., active agonist in all samples (substances)]. The rows corresponding to these compounds are redundant, so we want remove them except for only one row for each compound.
df = df.drop_duplicates(subset='cid') # remove duplicate rows except for the first occurring row.
print(len(df['sid'].unique()))
print(len(df['cid'].unique()))
6791
6791
3-(4) Adding “numeric” activity classes#
In general, the inputs and outputs to machine learning algorithms need to have numerical forms.
In this practice, the input (molecular structure) will be represented with binary fingerprints, which already have numerical forms (0 or 1). However, the output (activity) is currently in a string format (e.g., ‘active agonist’, ‘active antagonist’). Therefore, we want to add an additional, ‘activity’ column, which contains numeric codes representing the active and inactive compounds:
1 for actives (either active agonists or active antagonists)
0 for inactives
Note that we are merging the two classes “active agonist” and “active antagonist”, because we are going to build a binary classifer that distinguish actives from inactives.
df['activity'] = [ 0 if x == 'inactive' else 1 for x in df['activity_summary'] ]
Check if the new column ‘activity’ is added to (the end of) the data frame.
df.head(3)
| pc_result_tag | sid | cid | PUBCHEM_EXT_DATASOURCE_SMILES | activity_outcome | activity_score | activity_url | assay_data_comment | activity_summary | antagonist_activity | antagonist_potency | antagonist_efficacy | viability_activity | viability_potency | viability_efficacy | sample_source | activity | |
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
| 3 | 1 | 144203552.0 | 12850184.0 | C(C(=O)[C@H]([C@@H]([C@H](C(=O)[O-])O)O)O)O.C(... | Inactive | 0.0 | NaN | NaN | inactive | inactive | NaN | 0 | inactive | NaN | 0 | NCI | 0 |
| 4 | 2 | 144203553.0 | 89753.0 | C([C@H]([C@H]([C@@H]([C@H](C(=O)[O-])O)O)O)O)O... | Inactive | 0.0 | NaN | NaN | inactive | inactive | NaN | 0 | inactive | NaN | 0 | NCI | 0 |
| 5 | 3 | 144203554.0 | 9403.0 | C[C@]12CC[C@H]3[C@H]([C@@H]1CC[C@@H]2OC(=O)CCC... | Inactive | 0.0 | NaN | NaN | inactive | inactive | NaN | 0 | inactive | NaN | 0 | NCI | 0 |
Double-check the count of active/inactive compounds.
df.groupby('activity_summary').count()
| pc_result_tag | sid | cid | PUBCHEM_EXT_DATASOURCE_SMILES | activity_outcome | activity_score | activity_url | assay_data_comment | antagonist_activity | antagonist_potency | antagonist_efficacy | viability_activity | viability_potency | viability_efficacy | sample_source | activity | |
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
| activity_summary | ||||||||||||||||
| active agonist | 451 | 451 | 451 | 451 | 451 | 451 | 0 | 0 | 451 | 451 | 451 | 451 | 44 | 432 | 451 | 451 |
| active antagonist | 290 | 290 | 290 | 290 | 290 | 290 | 0 | 0 | 290 | 289 | 290 | 290 | 88 | 275 | 290 | 290 |
| inactive | 6050 | 6050 | 6050 | 6050 | 6050 | 6050 | 0 | 0 | 6050 | 0 | 6050 | 6050 | 269 | 5964 | 6050 | 6050 |
df.groupby('activity').count()
| pc_result_tag | sid | cid | PUBCHEM_EXT_DATASOURCE_SMILES | activity_outcome | activity_score | activity_url | assay_data_comment | activity_summary | antagonist_activity | antagonist_potency | antagonist_efficacy | viability_activity | viability_potency | viability_efficacy | sample_source | |
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
| activity | ||||||||||||||||
| 0 | 6050 | 6050 | 6050 | 6050 | 6050 | 6050 | 0 | 0 | 6050 | 6050 | 0 | 6050 | 6050 | 269 | 5964 | 6050 |
| 1 | 741 | 741 | 741 | 741 | 741 | 741 | 0 | 0 | 741 | 741 | 740 | 741 | 741 | 132 | 707 | 741 |
3-(5) Create a smaller data frame that only contains CIDs and activities.#
Let’s create a smaller data frame that only contains CIDs and activities. This data frame will be merged with a data frame containing molecular fingerprint information.
df_activity = df[['cid','activity']]
df_activity.head(5)
| cid | activity | |
|---|---|---|
| 3 | 12850184.0 | 0 |
| 4 | 89753.0 | 0 |
| 5 | 9403.0 | 0 |
| 6 | 13218779.0 | 0 |
| 12 | 637566.0 | 0 |
4. Download structure information for each compound from PubChem#
Now we want to get structure information of the compounds from PubChem (in isomeric SMILES).
cids = df.cid.astype(int).tolist()
chunk_size = 200
num_cids = len(cids)
if num_cids % chunk_size == 0 :
num_chunks = int( num_cids / chunk_size )
else :
num_chunks = int( num_cids / chunk_size ) + 1
print("# CIDs = ", num_cids)
print("# CID Chunks = ", num_chunks, "(chunked by ", chunk_size, ")")
# CIDs = 6791
# CID Chunks = 34 (chunked by 200 )
import time
import requests
from io import StringIO
df_smiles = pd.DataFrame()
list_dfs = [] # temporary list of data frames
for i in range(0, num_chunks) :
idx1 = chunk_size * i
idx2 = chunk_size * (i + 1)
cidstr = ",".join( str(x) for x in cids[idx1:idx2] )
url = ('https://pubchem.ncbi.nlm.nih.gov/rest/pug/compound/cid/' + cidstr + '/property/IsomericSMILES/TXT')
res = requests.get(url)
data = pd.read_csv( StringIO(res.text), header=None, names=['smiles'] )
list_dfs.append(data)
time.sleep(0.2)
if ( i % 5 == 0 ) :
print("Processing Chunk ", i)
# if ( i == 2 ) : break #- for debugging
df_smiles = pd.concat(list_dfs,ignore_index=True)
df_smiles[ 'cid' ] = cids
df_smiles.head(5)
Processing Chunk 0
Processing Chunk 5
Processing Chunk 10
Processing Chunk 15
Processing Chunk 20
Processing Chunk 25
Processing Chunk 30
---------------------------------------------------------------------------
ValueError Traceback (most recent call last)
Cell In[29], line 27
24 # if ( i == 2 ) : break #- for debugging
26 df_smiles = pd.concat(list_dfs,ignore_index=True)
---> 27 df_smiles[ 'cid' ] = cids
28 df_smiles.head(5)
File ~/Desktop/my-book-files/venv/lib64/python3.9/site-packages/pandas/core/frame.py:4316, in DataFrame.__setitem__(self, key, value)
4313 self._setitem_array([key], value)
4314 else:
4315 # set column
-> 4316 self._set_item(key, value)
File ~/Desktop/my-book-files/venv/lib64/python3.9/site-packages/pandas/core/frame.py:4529, in DataFrame._set_item(self, key, value)
4519 def _set_item(self, key, value) -> None:
4520 """
4521 Add series to DataFrame in specified column.
4522
(...)
4527 ensure homogeneity.
4528 """
-> 4529 value, refs = self._sanitize_column(value)
4531 if (
4532 key in self.columns
4533 and value.ndim == 1
4534 and not isinstance(value.dtype, ExtensionDtype)
4535 ):
4536 # broadcast across multiple columns if necessary
4537 if not self.columns.is_unique or isinstance(self.columns, MultiIndex):
File ~/Desktop/my-book-files/venv/lib64/python3.9/site-packages/pandas/core/frame.py:5273, in DataFrame._sanitize_column(self, value)
5270 return _reindex_for_setitem(value, self.index)
5272 if is_list_like(value):
-> 5273 com.require_length_match(value, self.index)
5274 arr = sanitize_array(value, self.index, copy=True, allow_2d=True)
5275 if (
5276 isinstance(value, Index)
5277 and value.dtype == "object"
(...)
5280 # TODO: Remove kludge in sanitize_array for string mode when enforcing
5281 # this deprecation
File ~/Desktop/my-book-files/venv/lib64/python3.9/site-packages/pandas/core/common.py:573, in require_length_match(data, index)
569 """
570 Check the length of data matches the length of the index.
571 """
572 if len(data) != len(index):
--> 573 raise ValueError(
574 "Length of values "
575 f"({len(data)}) "
576 "does not match length of index "
577 f"({len(index)})"
578 )
ValueError: Length of values (6791) does not match length of index (102)
len(df_smiles)
6798
df_smiles = df_smiles[['cid','smiles']]
df_smiles.head(5)
| cid | smiles | |
|---|---|---|
| 0 | 12850184 | C(C(=O)[C@H]([C@@H]([C@H](C(=O)[O-])O)O)O)O.C(... |
| 1 | 89753 | C([C@H]([C@H]([C@@H]([C@H](C(=O)[O-])O)O)O)O)O... |
| 2 | 9403 | C[C@]12CC[C@H]3[C@H]([C@@H]1CC[C@@H]2OC(=O)CCC... |
| 3 | 13218779 | C[C@@]12CC[C@@H](C1(C)C)C[C@H]2OC(=O)CSC#N |
| 4 | 637566 | CC(=CCC/C(=C/CO)/C)C |
5. Generate MACCS keys from SMILES.#
from rdkit import Chem
from rdkit.Chem import MACCSkeys
fps=dict()
for idx, row in df_smiles.iterrows() :
mol = Chem.MolFromSmiles(row.smiles)
if mol == None :
print("Can't generate MOL object:", "CID", row.cid, row.smiles)
else:
fps[row.cid] = [row.cid] + list(MACCSkeys.GenMACCSKeys(mol).ToBitString())
Can't generate MOL object: CID 28145 [NH4+].[NH4+].F[Si-2](F)(F)(F)(F)F
Can't generate MOL object: CID 28127 F[Si-2](F)(F)(F)(F)F.[Na+].[Na+]
# Generate column names
fpbitnames = []
fpbitnames.append('cid')
for i in range(0,167): # from MACCS000 to MACCS166
fpbitnames.append( "maccs" + str(i).zfill(3) )
df_fps = pd.DataFrame.from_dict(fps, orient='index', columns=fpbitnames)
df_fps.head(5)
| cid | maccs000 | maccs001 | maccs002 | maccs003 | maccs004 | maccs005 | maccs006 | maccs007 | maccs008 | ... | maccs157 | maccs158 | maccs159 | maccs160 | maccs161 | maccs162 | maccs163 | maccs164 | maccs165 | maccs166 | |
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
| 12850184 | 12850184 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | ... | 1 | 0 | 1 | 0 | 0 | 0 | 0 | 1 | 0 | 1 |
| 89753 | 89753 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | ... | 1 | 0 | 1 | 0 | 0 | 0 | 0 | 1 | 0 | 1 |
| 9403 | 9403 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | ... | 1 | 0 | 1 | 1 | 0 | 1 | 1 | 1 | 1 | 0 |
| 13218779 | 13218779 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | ... | 1 | 0 | 1 | 1 | 1 | 0 | 1 | 1 | 1 | 0 |
| 637566 | 637566 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | ... | 1 | 0 | 0 | 1 | 0 | 0 | 0 | 1 | 0 | 0 |
5 rows × 168 columns
6. Merge activity data and fingerprint information#
df_activity.head(3)
| cid | activity | |
|---|---|---|
| 3 | 12850184.0 | 0 |
| 4 | 89753.0 | 0 |
| 5 | 9403.0 | 0 |
df_fps.head(3)
| cid | maccs000 | maccs001 | maccs002 | maccs003 | maccs004 | maccs005 | maccs006 | maccs007 | maccs008 | ... | maccs157 | maccs158 | maccs159 | maccs160 | maccs161 | maccs162 | maccs163 | maccs164 | maccs165 | maccs166 | |
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
| 12850184 | 12850184 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | ... | 1 | 0 | 1 | 0 | 0 | 0 | 0 | 1 | 0 | 1 |
| 89753 | 89753 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | ... | 1 | 0 | 1 | 0 | 0 | 0 | 0 | 1 | 0 | 1 |
| 9403 | 9403 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | ... | 1 | 0 | 1 | 1 | 0 | 1 | 1 | 1 | 1 | 0 |
3 rows × 168 columns
df_data = df_activity.join(df_fps.set_index('cid'), on='cid')
In Section 5, there were two CIDs for which the MACCS keys could not be generated. They need to be removed from df_data.
df_data[df_data.isna().any(axis=1)]
| cid | activity | maccs000 | maccs001 | maccs002 | maccs003 | maccs004 | maccs005 | maccs006 | maccs007 | ... | maccs157 | maccs158 | maccs159 | maccs160 | maccs161 | maccs162 | maccs163 | maccs164 | maccs165 | maccs166 | |
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
| 2293 | 28145.0 | 0 | NaN | NaN | NaN | NaN | NaN | NaN | NaN | NaN | ... | NaN | NaN | NaN | NaN | NaN | NaN | NaN | NaN | NaN | NaN |
| 9077 | 28127.0 | 0 | NaN | NaN | NaN | NaN | NaN | NaN | NaN | NaN | ... | NaN | NaN | NaN | NaN | NaN | NaN | NaN | NaN | NaN | NaN |
2 rows × 169 columns
df_data = df_data.dropna()
len(df_data)
6796
Save df_data in CSV for future use.
df_data.to_csv('df_data.csv')
7. Preparation for model building#
7-(1) Loading the data into X and y.#
df_data.head(3)
| cid | activity | maccs000 | maccs001 | maccs002 | maccs003 | maccs004 | maccs005 | maccs006 | maccs007 | ... | maccs157 | maccs158 | maccs159 | maccs160 | maccs161 | maccs162 | maccs163 | maccs164 | maccs165 | maccs166 | |
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
| 3 | 12850184.0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | ... | 1 | 0 | 1 | 0 | 0 | 0 | 0 | 1 | 0 | 1 |
| 4 | 89753.0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | ... | 1 | 0 | 1 | 0 | 0 | 0 | 0 | 1 | 0 | 1 |
| 5 | 9403.0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | ... | 1 | 0 | 1 | 1 | 0 | 1 | 1 | 1 | 1 | 0 |
3 rows × 169 columns
X = df_data.iloc[:,2:]
y = df_data['activity'].values
X.head(3)
| maccs000 | maccs001 | maccs002 | maccs003 | maccs004 | maccs005 | maccs006 | maccs007 | maccs008 | maccs009 | ... | maccs157 | maccs158 | maccs159 | maccs160 | maccs161 | maccs162 | maccs163 | maccs164 | maccs165 | maccs166 | |
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
| 3 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | ... | 1 | 0 | 1 | 0 | 0 | 0 | 0 | 1 | 0 | 1 |
| 4 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | ... | 1 | 0 | 1 | 0 | 0 | 0 | 0 | 1 | 0 | 1 |
| 5 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | ... | 1 | 0 | 1 | 1 | 0 | 1 | 1 | 1 | 1 | 0 |
3 rows × 167 columns
print(len(y)) # Number of all compounds
y.sum() # Number of actives
6796
742
7-(2) Remove zero-variance features#
Some features in X are not helpful in distinguishing actives from inactives, because they are set ON for all compounds or OFF for all compounds. Such features need to be removed because they would consume more computational resources without improving the model.
from sklearn.feature_selection import VarianceThreshold
X.shape #- Before removal
(6796, 167)
sel = VarianceThreshold()
X=sel.fit_transform(X)
X.shape #- After removal
(6796, 163)
In this case, four features had zero variances. Note that one of them is the first bit (maccs000) of the MACCS keys, which is added as a “dummy” to name each of bits 1~166 as maccs001, maccs002, … maccs166.
7-(3) Train-Test-Split (a 9:1 ratio)#
Now split the data set into a training set (90%) and test set (10%). The training set will be used to train the model. The developed model will be tested against the test set.
from sklearn.model_selection import train_test_split
X_train, X_test, y_train, y_test = \
train_test_split(X, y, shuffle=True, random_state=3100, stratify=y, test_size=0.1)
print(X_train.shape, X_test.shape, y_train.shape, y_test.shape)
print(y_train.sum(), y_test.sum())
(6116, 163) (680, 163) (6116,) (680,)
668 74
7-(4) Balance the training set through downsampling#
Check the dimension of the training data set.
print(len(y_train))
print(len(X_train))
print(len(X_train[0]))
6116
6116
163
Check the number of actives and inactives compound.
print("# inactives : ", len(y_train) - y_train.sum())
print("# actives : ", y_train.sum())
# inactives : 5448
# actives : 668
The data set is highly imbalanced [the inactive to active ratio is 8.16 (=5448 / 668)]. To address this issue, let’s downsample the majority class (inactive compounds) to balance the data set.
# Indicies of each class' observations
idx_inactives = np.where( y_train == 0 )[0]
idx_actives = np.where( y_train == 1 )[0]
# Number of observations in each class
num_inactives = len(idx_inactives)
num_actives = len(idx_actives)
# Randomly sample from inactives without replacement
np.random.seed(0)
idx_inactives_downsampled = np.random.choice(idx_inactives, size=num_actives, replace=False)
# Join together downsampled inactives with actives
X_train = np.vstack((X_train[idx_inactives_downsampled], X_train[idx_actives]))
y_train = np.hstack((y_train[idx_inactives_downsampled], y_train[idx_actives]))
It is noteworthy that np.vstack is used for X_train and np.hstack is used for Y_train. The direction of stacking is different because X_train is a 2-D array and y_train is a 1-D array.
Confirm that the downsampled data set has the correct dimension and active/inactive counts.
print("# inactives : ", len(y_train) - y_train.sum())
print("# actives : ", y_train.sum())
# inactives : 668
# actives : 668
print(len(y_train))
print(len(X_train))
print(len(X_train[0]))
1336
1336
163
9. 8. Build a model using the training set.#
Now we are ready to build predictive models using machine learning algorithms available in the scikit-learn library (https://scikit-learn.org/). This notebook will use Naive Bayes and decisiont tree, because they are relatively fast and simple.
from sklearn.naive_bayes import BernoulliNB #-- Naive Bayes
from sklearn.tree import DecisionTreeClassifier #-- Decision Tree
from sklearn.metrics import classification_report
from sklearn.metrics import confusion_matrix
from sklearn.metrics import accuracy_score
from sklearn.metrics import roc_auc_score
8-(1) Naive Bayes#
clf = BernoulliNB() # set up the NB classification model
clf.fit( X_train ,y_train ) # Train the model by fitting it to the data.
BernoulliNB(alpha=1.0, binarize=0.0, class_prior=None, fit_prior=True)
y_true, y_pred = y_train, clf.predict( X_train ) # Apply the model to predict the training compound's activity.
CMat = confusion_matrix( y_true, y_pred ) #-- generate confusion matrix
print(CMat) # [[TN, FP],
# [FN, TP]]
[[462 206]
[199 469]]
acc = accuracy_score( y_true, y_pred )
sens = CMat[ 1 ][ 1 ] / ( CMat[ 1 ][ 0 ] + CMat[ 1 ][ 1 ] ) # TP / (FN + TP)
spec = CMat[ 0 ][ 0 ] / ( CMat[ 0 ][ 0 ] + CMat[ 0 ][ 1 ] ) # TN / (TN + FP )
bacc = (sens + spec) / 2
y_score = clf.predict_proba( X_train )[:, 1]
auc = roc_auc_score( y_true, y_score )
print("#-- Accuracy = ", acc)
print("#-- Balanced Accuracy = ", bacc)
print("#-- Sensitivity = ", sens)
print("#-- Specificity = ", spec)
print("#-- AUC-ROC = ", auc)
#-- Accuracy = 0.6968562874251497
#-- Balanced Accuracy = 0.6968562874251496
#-- Sensitivity = 0.7020958083832335
#-- Specificity = 0.6916167664670658
#-- AUC-ROC = 0.7496985818781599
When applied to predict the activity of the training compounds, the NB classifier resulted in the accuracy of 0.70 and AUC-ROC of 0.75. However, the real performance of the model should be evaluated with the test set data, which are not used for model training.
y_true, y_pred = y_test, clf.predict(X_test) #-- Apply the model to predict the test set compounds' activity.
CMat = confusion_matrix( y_true, y_pred ) #-- generate confusion matrix
print(CMat) # [[TN, FP],
# [FN, TP]]
[[412 194]
[ 28 46]]
acc = accuracy_score( y_true, y_pred )
sens = CMat[ 1 ][ 1 ] / ( CMat[ 1 ][ 0 ] + CMat[ 1 ][ 1 ] )
spec = CMat[ 0 ][ 0 ] / ( CMat[ 0 ][ 0 ] + CMat[ 0 ][ 1 ] )
bacc = (sens + spec) / 2
y_score = clf.predict_proba( X_test )[:, 1]
auc = roc_auc_score( y_true, y_score )
print("#-- Accuracy = ", acc)
print("#-- Balanced Accuracy = ", bacc)
print("#-- Sensitivity = ", sens)
print("#-- Specificity = ", spec)
print("#-- AUC-ROC = ", auc)
#-- Accuracy = 0.6735294117647059
#-- Balanced Accuracy = 0.6507448042101507
#-- Sensitivity = 0.6216216216216216
#-- Specificity = 0.6798679867986799
#-- AUC-ROC = 0.724099099099099
For the test set, the accuracy is 0.67 and the AUC-ROC is 0.72. These values are somewhat smaller (by 0.03) than those for the training set. Also note that the accuracy is no longer the same as the balanced accruacy (which is the average of the sensitivity and specificity).
Some additional performance information may be obtained using classification_report().
print( classification_report(y_true, y_pred))
precision recall f1-score support
0 0.94 0.68 0.79 606
1 0.19 0.62 0.29 74
accuracy 0.67 680
macro avg 0.56 0.65 0.54 680
weighted avg 0.86 0.67 0.73 680
8-(2) Decision Tree#
clf = DecisionTreeClassifier( random_state=0 ) # set up the DT classification model
clf.fit( X_train ,y_train ) # Train the model by fitting it to the data (using the default values for all parameters)
DecisionTreeClassifier(class_weight=None, criterion='gini', max_depth=None,
max_features=None, max_leaf_nodes=None,
min_impurity_decrease=0.0, min_impurity_split=None,
min_samples_leaf=1, min_samples_split=2,
min_weight_fraction_leaf=0.0, presort=False,
random_state=0, splitter='best')
y_true, y_pred = y_train, clf.predict( X_train ) # Apply the model to predict the training compound's activity.
CMat = confusion_matrix( y_true, y_pred ) #-- generate confusion matrix
print(CMat) # [[TN, FP],
# [FN, TP]]
[[663 5]
[ 3 665]]
acc = accuracy_score( y_true, y_pred )
sens = CMat[ 1 ][ 1 ] / ( CMat[ 1 ][ 0 ] + CMat[ 1 ][ 1 ] ) # TP / (FN + TP)
spec = CMat[ 0 ][ 0 ] / ( CMat[ 0 ][ 0 ] + CMat[ 0 ][ 1 ] ) # TN / (TN + FP )
bacc = (sens + spec) / 2
y_score = clf.predict_proba( X_train )[:, 1]
auc = roc_auc_score( y_true, y_score )
print("#-- Accuracy = ", acc)
print("#-- Balanced Accuracy = ", bacc)
print("#-- Sensitivity = ", sens)
print("#-- Specificity = ", spec)
print("#-- AUC-ROC = ", auc)
#-- Accuracy = 0.9940119760479041
#-- Balanced Accuracy = 0.9940119760479043
#-- Sensitivity = 0.9955089820359282
#-- Specificity = 0.9925149700598802
#-- AUC-ROC = 0.9998890691670551
When applied to predict the activity of the training compounds, the DT classifier resulted in very high scores (>0.99) for all five performance measures considered here. However, it does not necessarily mean that the model will perform very well for the test set compounds. Let’s apply the model to the test set.
y_true, y_pred = y_test, clf.predict(X_test) #-- Apply the model to predict the test set compounds' activity.
CMat = confusion_matrix( y_true, y_pred ) #-- generate confusion matrix
print(CMat) # [[TN, FP],
# [FN, TP]]
[[422 184]
[ 32 42]]
acc = accuracy_score( y_true, y_pred )
sens = CMat[ 1 ][ 1 ] / ( CMat[ 1 ][ 0 ] + CMat[ 1 ][ 1 ] )
spec = CMat[ 0 ][ 0 ] / ( CMat[ 0 ][ 0 ] + CMat[ 0 ][ 1 ] )
bacc = (sens + spec) / 2
y_score = clf.predict_proba( X_test )[:, 1]
auc = roc_auc_score( y_true, y_score )
print("#-- Accuracy = ", acc)
print("#-- Balanced Accuracy = ", bacc)
print("#-- Sensitivity = ", sens)
print("#-- Specificity = ", spec)
print("#-- AUC-ROC = ", auc)
#-- Accuracy = 0.6823529411764706
#-- Balanced Accuracy = 0.6319686022656319
#-- Sensitivity = 0.5675675675675675
#-- Specificity = 0.6963696369636964
#-- AUC-ROC = 0.6298724467041299
When the DT model was applied to the test set, all performance measures were much worse than those for the training set. This is a typical example of outfitting.
9. Model building through cross-validation#
In the above section, the models were developed using the default values for many optional hyperparamters, which cannot be learned by the training algorithm. For example, when building a decision tree model, one should specify how the tree should be deep, how many compounds should be allowed in a single leaf, what is the minimum number of compounds in a single leaf, etc.
The cells below demonstrate how to perform hyperparameter optimization through 10-fold cross-validation. In this example, five values for each of three hyperparameters used in decision tree are considered (max_depth, min_samples_split, and min_samples_leaf), resulting in a total of 125 combination of the parameter values (=5 x 5 x 5). For each combination, 10 models are generated (through 10-fold cross validation) and the average performance will be tracked. The goal is to find the parameter value combination that results in the highest average performance score (e.g., ‘roc_auc’) from the 10-fold cross validation.
from sklearn.model_selection import GridSearchCV
scores = [ 'roc_auc', 'balanced_accuracy' ]
ncvs = 10
max_depth_range = np.linspace( 3, 7, num=5, dtype='int32' )
min_samples_split_range = np.linspace( 3, 7, num=5, dtype='int32' )
min_samples_leaf_range = np.linspace( 2, 6, num=5, dtype='int32' )
param_grid = dict( max_depth=max_depth_range,
min_samples_split=min_samples_split_range,
min_samples_leaf=min_samples_leaf_range )
clf = GridSearchCV( DecisionTreeClassifier( random_state=0 ),
param_grid=param_grid, cv=ncvs, scoring=scores, refit='roc_auc',
return_train_score = True, iid=False)
clf.fit( X_train, y_train )
print("Best parameter set", clf.best_params_)
Best parameter set {'max_depth': 5, 'min_samples_leaf': 4, 'min_samples_split': 3}
If necessary, it is possible to look into the performance data for each parameter value combination (stored in clf.cv_results_), as shown in the following cell.
means_1a = clf.cv_results_['mean_train_roc_auc']
stds_1a = clf.cv_results_['std_train_roc_auc']
means_1b = clf.cv_results_['mean_test_roc_auc']
stds_1b = clf.cv_results_['std_test_roc_auc']
means_2a = clf.cv_results_['mean_train_balanced_accuracy']
stds_2a = clf.cv_results_['std_train_balanced_accuracy']
means_2b = clf.cv_results_['mean_test_balanced_accuracy']
stds_2b = clf.cv_results_['std_test_balanced_accuracy']
iterobjs = zip( means_1a, stds_1a, means_1b, stds_1b,
means_2a, stds_2a, means_2b, stds_2b, clf.cv_results_['params'] )
for m1a, s1a, m1b, s1b, m2a, s2a, m2b, s2b, params in iterobjs :
print( "Grid %r : %0.4f %0.04f %0.4f %0.04f %0.4f %0.04f %0.4f %0.04f"
% ( params, m1a, s1a, m1b, s1b, m2a, s2a, m2b, s2b))
Grid {'max_depth': 3, 'min_samples_leaf': 2, 'min_samples_split': 3} : 0.7714 0.0042 0.7542 0.0420 0.7264 0.0052 0.7019 0.0370
Grid {'max_depth': 3, 'min_samples_leaf': 2, 'min_samples_split': 4} : 0.7714 0.0042 0.7542 0.0420 0.7264 0.0052 0.7019 0.0370
Grid {'max_depth': 3, 'min_samples_leaf': 2, 'min_samples_split': 5} : 0.7714 0.0042 0.7542 0.0420 0.7264 0.0052 0.7019 0.0370
Grid {'max_depth': 3, 'min_samples_leaf': 2, 'min_samples_split': 6} : 0.7714 0.0042 0.7542 0.0420 0.7264 0.0052 0.7019 0.0370
Grid {'max_depth': 3, 'min_samples_leaf': 2, 'min_samples_split': 7} : 0.7714 0.0042 0.7542 0.0420 0.7264 0.0052 0.7019 0.0370
Grid {'max_depth': 3, 'min_samples_leaf': 3, 'min_samples_split': 3} : 0.7714 0.0042 0.7542 0.0420 0.7264 0.0052 0.7019 0.0370
Grid {'max_depth': 3, 'min_samples_leaf': 3, 'min_samples_split': 4} : 0.7714 0.0042 0.7542 0.0420 0.7264 0.0052 0.7019 0.0370
Grid {'max_depth': 3, 'min_samples_leaf': 3, 'min_samples_split': 5} : 0.7714 0.0042 0.7542 0.0420 0.7264 0.0052 0.7019 0.0370
Grid {'max_depth': 3, 'min_samples_leaf': 3, 'min_samples_split': 6} : 0.7714 0.0042 0.7542 0.0420 0.7264 0.0052 0.7019 0.0370
Grid {'max_depth': 3, 'min_samples_leaf': 3, 'min_samples_split': 7} : 0.7714 0.0042 0.7542 0.0420 0.7264 0.0052 0.7019 0.0370
Grid {'max_depth': 3, 'min_samples_leaf': 4, 'min_samples_split': 3} : 0.7714 0.0042 0.7542 0.0420 0.7264 0.0052 0.7019 0.0370
Grid {'max_depth': 3, 'min_samples_leaf': 4, 'min_samples_split': 4} : 0.7714 0.0042 0.7542 0.0420 0.7264 0.0052 0.7019 0.0370
Grid {'max_depth': 3, 'min_samples_leaf': 4, 'min_samples_split': 5} : 0.7714 0.0042 0.7542 0.0420 0.7264 0.0052 0.7019 0.0370
Grid {'max_depth': 3, 'min_samples_leaf': 4, 'min_samples_split': 6} : 0.7714 0.0042 0.7542 0.0420 0.7264 0.0052 0.7019 0.0370
Grid {'max_depth': 3, 'min_samples_leaf': 4, 'min_samples_split': 7} : 0.7714 0.0042 0.7542 0.0420 0.7264 0.0052 0.7019 0.0370
Grid {'max_depth': 3, 'min_samples_leaf': 5, 'min_samples_split': 3} : 0.7714 0.0042 0.7542 0.0420 0.7264 0.0052 0.7019 0.0370
Grid {'max_depth': 3, 'min_samples_leaf': 5, 'min_samples_split': 4} : 0.7714 0.0042 0.7542 0.0420 0.7264 0.0052 0.7019 0.0370
Grid {'max_depth': 3, 'min_samples_leaf': 5, 'min_samples_split': 5} : 0.7714 0.0042 0.7542 0.0420 0.7264 0.0052 0.7019 0.0370
Grid {'max_depth': 3, 'min_samples_leaf': 5, 'min_samples_split': 6} : 0.7714 0.0042 0.7542 0.0420 0.7264 0.0052 0.7019 0.0370
Grid {'max_depth': 3, 'min_samples_leaf': 5, 'min_samples_split': 7} : 0.7714 0.0042 0.7542 0.0420 0.7264 0.0052 0.7019 0.0370
Grid {'max_depth': 3, 'min_samples_leaf': 6, 'min_samples_split': 3} : 0.7714 0.0042 0.7542 0.0420 0.7264 0.0052 0.7019 0.0370
Grid {'max_depth': 3, 'min_samples_leaf': 6, 'min_samples_split': 4} : 0.7714 0.0042 0.7542 0.0420 0.7264 0.0052 0.7019 0.0370
Grid {'max_depth': 3, 'min_samples_leaf': 6, 'min_samples_split': 5} : 0.7714 0.0042 0.7542 0.0420 0.7264 0.0052 0.7019 0.0370
Grid {'max_depth': 3, 'min_samples_leaf': 6, 'min_samples_split': 6} : 0.7714 0.0042 0.7542 0.0420 0.7264 0.0052 0.7019 0.0370
Grid {'max_depth': 3, 'min_samples_leaf': 6, 'min_samples_split': 7} : 0.7714 0.0042 0.7542 0.0420 0.7264 0.0052 0.7019 0.0370
Grid {'max_depth': 4, 'min_samples_leaf': 2, 'min_samples_split': 3} : 0.8051 0.0053 0.7630 0.0501 0.7556 0.0075 0.7244 0.0376
Grid {'max_depth': 4, 'min_samples_leaf': 2, 'min_samples_split': 4} : 0.8051 0.0053 0.7630 0.0501 0.7556 0.0075 0.7244 0.0376
Grid {'max_depth': 4, 'min_samples_leaf': 2, 'min_samples_split': 5} : 0.8051 0.0053 0.7630 0.0501 0.7556 0.0075 0.7244 0.0376
Grid {'max_depth': 4, 'min_samples_leaf': 2, 'min_samples_split': 6} : 0.8051 0.0053 0.7630 0.0501 0.7556 0.0075 0.7244 0.0376
Grid {'max_depth': 4, 'min_samples_leaf': 2, 'min_samples_split': 7} : 0.8051 0.0053 0.7630 0.0501 0.7556 0.0075 0.7244 0.0376
Grid {'max_depth': 4, 'min_samples_leaf': 3, 'min_samples_split': 3} : 0.8051 0.0054 0.7603 0.0516 0.7554 0.0073 0.7237 0.0386
Grid {'max_depth': 4, 'min_samples_leaf': 3, 'min_samples_split': 4} : 0.8051 0.0054 0.7603 0.0516 0.7554 0.0073 0.7237 0.0386
Grid {'max_depth': 4, 'min_samples_leaf': 3, 'min_samples_split': 5} : 0.8051 0.0054 0.7603 0.0516 0.7554 0.0073 0.7237 0.0386
Grid {'max_depth': 4, 'min_samples_leaf': 3, 'min_samples_split': 6} : 0.8051 0.0054 0.7603 0.0516 0.7554 0.0073 0.7237 0.0386
Grid {'max_depth': 4, 'min_samples_leaf': 3, 'min_samples_split': 7} : 0.8051 0.0054 0.7603 0.0516 0.7554 0.0073 0.7237 0.0386
Grid {'max_depth': 4, 'min_samples_leaf': 4, 'min_samples_split': 3} : 0.8042 0.0056 0.7586 0.0506 0.7544 0.0074 0.7237 0.0386
Grid {'max_depth': 4, 'min_samples_leaf': 4, 'min_samples_split': 4} : 0.8042 0.0056 0.7586 0.0506 0.7544 0.0074 0.7237 0.0386
Grid {'max_depth': 4, 'min_samples_leaf': 4, 'min_samples_split': 5} : 0.8042 0.0056 0.7586 0.0506 0.7544 0.0074 0.7237 0.0386
Grid {'max_depth': 4, 'min_samples_leaf': 4, 'min_samples_split': 6} : 0.8042 0.0056 0.7586 0.0506 0.7544 0.0074 0.7237 0.0386
Grid {'max_depth': 4, 'min_samples_leaf': 4, 'min_samples_split': 7} : 0.8042 0.0056 0.7586 0.0506 0.7544 0.0074 0.7237 0.0386
Grid {'max_depth': 4, 'min_samples_leaf': 5, 'min_samples_split': 3} : 0.8043 0.0056 0.7592 0.0494 0.7528 0.0069 0.7229 0.0401
Grid {'max_depth': 4, 'min_samples_leaf': 5, 'min_samples_split': 4} : 0.8043 0.0056 0.7592 0.0494 0.7528 0.0069 0.7229 0.0401
Grid {'max_depth': 4, 'min_samples_leaf': 5, 'min_samples_split': 5} : 0.8043 0.0056 0.7592 0.0494 0.7528 0.0069 0.7229 0.0401
Grid {'max_depth': 4, 'min_samples_leaf': 5, 'min_samples_split': 6} : 0.8043 0.0056 0.7592 0.0494 0.7528 0.0069 0.7229 0.0401
Grid {'max_depth': 4, 'min_samples_leaf': 5, 'min_samples_split': 7} : 0.8043 0.0056 0.7592 0.0494 0.7528 0.0069 0.7229 0.0401
Grid {'max_depth': 4, 'min_samples_leaf': 6, 'min_samples_split': 3} : 0.8041 0.0055 0.7573 0.0511 0.7527 0.0068 0.7214 0.0421
Grid {'max_depth': 4, 'min_samples_leaf': 6, 'min_samples_split': 4} : 0.8041 0.0055 0.7573 0.0511 0.7527 0.0068 0.7214 0.0421
Grid {'max_depth': 4, 'min_samples_leaf': 6, 'min_samples_split': 5} : 0.8041 0.0055 0.7573 0.0511 0.7527 0.0068 0.7214 0.0421
Grid {'max_depth': 4, 'min_samples_leaf': 6, 'min_samples_split': 6} : 0.8041 0.0055 0.7573 0.0511 0.7527 0.0068 0.7214 0.0421
Grid {'max_depth': 4, 'min_samples_leaf': 6, 'min_samples_split': 7} : 0.8041 0.0055 0.7573 0.0511 0.7527 0.0068 0.7214 0.0421
Grid {'max_depth': 5, 'min_samples_leaf': 2, 'min_samples_split': 3} : 0.8389 0.0049 0.7560 0.0416 0.7794 0.0073 0.7139 0.0439
Grid {'max_depth': 5, 'min_samples_leaf': 2, 'min_samples_split': 4} : 0.8389 0.0049 0.7560 0.0416 0.7794 0.0073 0.7139 0.0439
Grid {'max_depth': 5, 'min_samples_leaf': 2, 'min_samples_split': 5} : 0.8389 0.0049 0.7560 0.0416 0.7794 0.0073 0.7139 0.0439
Grid {'max_depth': 5, 'min_samples_leaf': 2, 'min_samples_split': 6} : 0.8387 0.0051 0.7567 0.0421 0.7793 0.0075 0.7139 0.0439
Grid {'max_depth': 5, 'min_samples_leaf': 2, 'min_samples_split': 7} : 0.8385 0.0050 0.7567 0.0421 0.7793 0.0075 0.7139 0.0439
Grid {'max_depth': 5, 'min_samples_leaf': 3, 'min_samples_split': 3} : 0.8380 0.0049 0.7595 0.0429 0.7782 0.0076 0.7139 0.0452
Grid {'max_depth': 5, 'min_samples_leaf': 3, 'min_samples_split': 4} : 0.8380 0.0049 0.7595 0.0429 0.7782 0.0076 0.7139 0.0452
Grid {'max_depth': 5, 'min_samples_leaf': 3, 'min_samples_split': 5} : 0.8380 0.0049 0.7595 0.0429 0.7782 0.0076 0.7139 0.0452
Grid {'max_depth': 5, 'min_samples_leaf': 3, 'min_samples_split': 6} : 0.8380 0.0049 0.7595 0.0429 0.7782 0.0076 0.7139 0.0452
Grid {'max_depth': 5, 'min_samples_leaf': 3, 'min_samples_split': 7} : 0.8379 0.0049 0.7595 0.0429 0.7782 0.0076 0.7139 0.0452
Grid {'max_depth': 5, 'min_samples_leaf': 4, 'min_samples_split': 3} : 0.8368 0.0059 0.7631 0.0381 0.7759 0.0078 0.7139 0.0461
Grid {'max_depth': 5, 'min_samples_leaf': 4, 'min_samples_split': 4} : 0.8368 0.0059 0.7631 0.0381 0.7759 0.0078 0.7139 0.0461
Grid {'max_depth': 5, 'min_samples_leaf': 4, 'min_samples_split': 5} : 0.8368 0.0059 0.7631 0.0381 0.7759 0.0078 0.7139 0.0461
Grid {'max_depth': 5, 'min_samples_leaf': 4, 'min_samples_split': 6} : 0.8368 0.0059 0.7631 0.0381 0.7759 0.0078 0.7139 0.0461
Grid {'max_depth': 5, 'min_samples_leaf': 4, 'min_samples_split': 7} : 0.8368 0.0059 0.7631 0.0381 0.7759 0.0078 0.7139 0.0461
Grid {'max_depth': 5, 'min_samples_leaf': 5, 'min_samples_split': 3} : 0.8383 0.0064 0.7593 0.0398 0.7760 0.0078 0.7102 0.0481
Grid {'max_depth': 5, 'min_samples_leaf': 5, 'min_samples_split': 4} : 0.8383 0.0064 0.7593 0.0398 0.7760 0.0078 0.7102 0.0481
Grid {'max_depth': 5, 'min_samples_leaf': 5, 'min_samples_split': 5} : 0.8383 0.0064 0.7593 0.0398 0.7760 0.0078 0.7102 0.0481
Grid {'max_depth': 5, 'min_samples_leaf': 5, 'min_samples_split': 6} : 0.8383 0.0064 0.7593 0.0398 0.7760 0.0078 0.7102 0.0481
Grid {'max_depth': 5, 'min_samples_leaf': 5, 'min_samples_split': 7} : 0.8383 0.0064 0.7593 0.0398 0.7760 0.0078 0.7102 0.0481
Grid {'max_depth': 5, 'min_samples_leaf': 6, 'min_samples_split': 3} : 0.8376 0.0060 0.7523 0.0444 0.7756 0.0075 0.7056 0.0499
Grid {'max_depth': 5, 'min_samples_leaf': 6, 'min_samples_split': 4} : 0.8376 0.0060 0.7523 0.0444 0.7756 0.0075 0.7056 0.0499
Grid {'max_depth': 5, 'min_samples_leaf': 6, 'min_samples_split': 5} : 0.8376 0.0060 0.7523 0.0444 0.7756 0.0075 0.7056 0.0499
Grid {'max_depth': 5, 'min_samples_leaf': 6, 'min_samples_split': 6} : 0.8376 0.0060 0.7523 0.0444 0.7756 0.0075 0.7056 0.0499
Grid {'max_depth': 5, 'min_samples_leaf': 6, 'min_samples_split': 7} : 0.8376 0.0060 0.7523 0.0444 0.7756 0.0075 0.7056 0.0499
Grid {'max_depth': 6, 'min_samples_leaf': 2, 'min_samples_split': 3} : 0.8749 0.0061 0.7356 0.0463 0.8009 0.0072 0.7042 0.0378
Grid {'max_depth': 6, 'min_samples_leaf': 2, 'min_samples_split': 4} : 0.8749 0.0061 0.7356 0.0463 0.8009 0.0072 0.7042 0.0378
Grid {'max_depth': 6, 'min_samples_leaf': 2, 'min_samples_split': 5} : 0.8749 0.0062 0.7356 0.0463 0.8009 0.0072 0.7042 0.0378
Grid {'max_depth': 6, 'min_samples_leaf': 2, 'min_samples_split': 6} : 0.8748 0.0062 0.7351 0.0465 0.8010 0.0072 0.7027 0.0379
Grid {'max_depth': 6, 'min_samples_leaf': 2, 'min_samples_split': 7} : 0.8740 0.0057 0.7370 0.0450 0.8002 0.0068 0.7042 0.0398
Grid {'max_depth': 6, 'min_samples_leaf': 3, 'min_samples_split': 3} : 0.8723 0.0057 0.7383 0.0549 0.7976 0.0070 0.7005 0.0413
Grid {'max_depth': 6, 'min_samples_leaf': 3, 'min_samples_split': 4} : 0.8723 0.0057 0.7383 0.0549 0.7976 0.0070 0.7005 0.0413
Grid {'max_depth': 6, 'min_samples_leaf': 3, 'min_samples_split': 5} : 0.8723 0.0057 0.7383 0.0549 0.7976 0.0070 0.7005 0.0413
Grid {'max_depth': 6, 'min_samples_leaf': 3, 'min_samples_split': 6} : 0.8723 0.0057 0.7383 0.0549 0.7976 0.0070 0.7005 0.0413
Grid {'max_depth': 6, 'min_samples_leaf': 3, 'min_samples_split': 7} : 0.8719 0.0058 0.7333 0.0477 0.7974 0.0070 0.6967 0.0364
Grid {'max_depth': 6, 'min_samples_leaf': 4, 'min_samples_split': 3} : 0.8697 0.0065 0.7397 0.0496 0.7947 0.0067 0.6989 0.0506
Grid {'max_depth': 6, 'min_samples_leaf': 4, 'min_samples_split': 4} : 0.8697 0.0065 0.7397 0.0496 0.7947 0.0067 0.6989 0.0506
Grid {'max_depth': 6, 'min_samples_leaf': 4, 'min_samples_split': 5} : 0.8697 0.0065 0.7397 0.0496 0.7947 0.0067 0.6989 0.0506
Grid {'max_depth': 6, 'min_samples_leaf': 4, 'min_samples_split': 6} : 0.8697 0.0065 0.7397 0.0496 0.7947 0.0067 0.6989 0.0506
Grid {'max_depth': 6, 'min_samples_leaf': 4, 'min_samples_split': 7} : 0.8697 0.0065 0.7397 0.0496 0.7947 0.0067 0.6989 0.0506
Grid {'max_depth': 6, 'min_samples_leaf': 5, 'min_samples_split': 3} : 0.8682 0.0063 0.7396 0.0522 0.7940 0.0079 0.6989 0.0547
Grid {'max_depth': 6, 'min_samples_leaf': 5, 'min_samples_split': 4} : 0.8682 0.0063 0.7396 0.0522 0.7940 0.0079 0.6989 0.0547
Grid {'max_depth': 6, 'min_samples_leaf': 5, 'min_samples_split': 5} : 0.8682 0.0063 0.7396 0.0522 0.7940 0.0079 0.6989 0.0547
Grid {'max_depth': 6, 'min_samples_leaf': 5, 'min_samples_split': 6} : 0.8682 0.0063 0.7396 0.0522 0.7940 0.0079 0.6989 0.0547
Grid {'max_depth': 6, 'min_samples_leaf': 5, 'min_samples_split': 7} : 0.8682 0.0063 0.7396 0.0522 0.7940 0.0079 0.6989 0.0547
Grid {'max_depth': 6, 'min_samples_leaf': 6, 'min_samples_split': 3} : 0.8661 0.0057 0.7392 0.0464 0.7921 0.0071 0.6974 0.0494
Grid {'max_depth': 6, 'min_samples_leaf': 6, 'min_samples_split': 4} : 0.8661 0.0057 0.7392 0.0464 0.7921 0.0071 0.6974 0.0494
Grid {'max_depth': 6, 'min_samples_leaf': 6, 'min_samples_split': 5} : 0.8661 0.0057 0.7392 0.0464 0.7921 0.0071 0.6974 0.0494
Grid {'max_depth': 6, 'min_samples_leaf': 6, 'min_samples_split': 6} : 0.8661 0.0057 0.7392 0.0464 0.7921 0.0071 0.6974 0.0494
Grid {'max_depth': 6, 'min_samples_leaf': 6, 'min_samples_split': 7} : 0.8661 0.0057 0.7392 0.0464 0.7921 0.0071 0.6974 0.0494
Grid {'max_depth': 7, 'min_samples_leaf': 2, 'min_samples_split': 3} : 0.9050 0.0072 0.7264 0.0549 0.8281 0.0087 0.6878 0.0467
Grid {'max_depth': 7, 'min_samples_leaf': 2, 'min_samples_split': 4} : 0.9050 0.0072 0.7264 0.0549 0.8281 0.0087 0.6878 0.0467
Grid {'max_depth': 7, 'min_samples_leaf': 2, 'min_samples_split': 5} : 0.9044 0.0072 0.7225 0.0545 0.8273 0.0085 0.6848 0.0468
Grid {'max_depth': 7, 'min_samples_leaf': 2, 'min_samples_split': 6} : 0.9041 0.0071 0.7202 0.0498 0.8273 0.0087 0.6818 0.0469
Grid {'max_depth': 7, 'min_samples_leaf': 2, 'min_samples_split': 7} : 0.9018 0.0068 0.7276 0.0555 0.8248 0.0080 0.6833 0.0456
Grid {'max_depth': 7, 'min_samples_leaf': 3, 'min_samples_split': 3} : 0.9007 0.0063 0.7261 0.0571 0.8231 0.0071 0.6818 0.0460
Grid {'max_depth': 7, 'min_samples_leaf': 3, 'min_samples_split': 4} : 0.9007 0.0063 0.7261 0.0571 0.8231 0.0071 0.6818 0.0460
Grid {'max_depth': 7, 'min_samples_leaf': 3, 'min_samples_split': 5} : 0.9007 0.0063 0.7261 0.0571 0.8231 0.0071 0.6818 0.0460
Grid {'max_depth': 7, 'min_samples_leaf': 3, 'min_samples_split': 6} : 0.9007 0.0063 0.7261 0.0571 0.8231 0.0071 0.6818 0.0460
Grid {'max_depth': 7, 'min_samples_leaf': 3, 'min_samples_split': 7} : 0.8992 0.0065 0.7292 0.0561 0.8214 0.0077 0.6841 0.0478
Grid {'max_depth': 7, 'min_samples_leaf': 4, 'min_samples_split': 3} : 0.8949 0.0074 0.7423 0.0598 0.8144 0.0083 0.6937 0.0460
Grid {'max_depth': 7, 'min_samples_leaf': 4, 'min_samples_split': 4} : 0.8949 0.0074 0.7423 0.0598 0.8144 0.0083 0.6937 0.0460
Grid {'max_depth': 7, 'min_samples_leaf': 4, 'min_samples_split': 5} : 0.8949 0.0074 0.7423 0.0598 0.8144 0.0083 0.6937 0.0460
Grid {'max_depth': 7, 'min_samples_leaf': 4, 'min_samples_split': 6} : 0.8949 0.0074 0.7423 0.0598 0.8144 0.0083 0.6937 0.0460
Grid {'max_depth': 7, 'min_samples_leaf': 4, 'min_samples_split': 7} : 0.8949 0.0074 0.7423 0.0598 0.8144 0.0083 0.6937 0.0460
Grid {'max_depth': 7, 'min_samples_leaf': 5, 'min_samples_split': 3} : 0.8921 0.0075 0.7416 0.0565 0.8116 0.0074 0.6878 0.0483
Grid {'max_depth': 7, 'min_samples_leaf': 5, 'min_samples_split': 4} : 0.8921 0.0075 0.7416 0.0565 0.8116 0.0074 0.6878 0.0483
Grid {'max_depth': 7, 'min_samples_leaf': 5, 'min_samples_split': 5} : 0.8921 0.0075 0.7416 0.0565 0.8116 0.0074 0.6878 0.0483
Grid {'max_depth': 7, 'min_samples_leaf': 5, 'min_samples_split': 6} : 0.8921 0.0075 0.7416 0.0565 0.8116 0.0074 0.6878 0.0483
Grid {'max_depth': 7, 'min_samples_leaf': 5, 'min_samples_split': 7} : 0.8921 0.0075 0.7416 0.0565 0.8116 0.0074 0.6878 0.0483
Grid {'max_depth': 7, 'min_samples_leaf': 6, 'min_samples_split': 3} : 0.8873 0.0072 0.7375 0.0524 0.8068 0.0064 0.6855 0.0413
Grid {'max_depth': 7, 'min_samples_leaf': 6, 'min_samples_split': 4} : 0.8873 0.0072 0.7375 0.0524 0.8068 0.0064 0.6855 0.0413
Grid {'max_depth': 7, 'min_samples_leaf': 6, 'min_samples_split': 5} : 0.8873 0.0072 0.7375 0.0524 0.8068 0.0064 0.6855 0.0413
Grid {'max_depth': 7, 'min_samples_leaf': 6, 'min_samples_split': 6} : 0.8873 0.0072 0.7375 0.0524 0.8068 0.0064 0.6855 0.0413
Grid {'max_depth': 7, 'min_samples_leaf': 6, 'min_samples_split': 7} : 0.8873 0.0072 0.7375 0.0524 0.8068 0.0064 0.6855 0.0413
Uncomment the following cell to look into additional performance data stored in cv_result_.
#print(clf.cv_result_)
It is important to understand that each model built through 10-fold cross-validation during hyperparameter optimization uses only 90% of the compounds in the training set and the remaining 10% is used for testing that model. After all parameter value combinations are evaluated, the best parameter values are selected and used to rebuild a model from all compounds in the training set. GridSearchCV() takes care of this last step automatically. Therefore, there is no need to take an extra step to build a model using cls.fit() after hyperparameter optimization.
y_true, y_pred = y_train, clf.predict( X_train ) # Apply the model to predict the training compound's activity.
CMat = confusion_matrix( y_true, y_pred ) #-- generate confusion matrix
print(CMat) # [[TN, FP],
# [FN, TP]]
[[543 125]
[179 489]]
acc = accuracy_score( y_true, y_pred )
sens = CMat[ 1 ][ 1 ] / ( CMat[ 1 ][ 0 ] + CMat[ 1 ][ 1 ] ) # TP / (FN + TP)
spec = CMat[ 0 ][ 0 ] / ( CMat[ 0 ][ 0 ] + CMat[ 0 ][ 1 ] ) # TN / (TN + FP )
bacc = (sens + spec) / 2
y_score = clf.predict_proba( X_train )[:, 1]
auc = roc_auc_score( y_true, y_score )
print("#-- Accuracy = ", acc)
print("#-- Balanced Accuracy = ", bacc)
print("#-- Sensitivity = ", sens)
print("#-- Specificity = ", spec)
print("#-- AUC-ROC = ", auc)
#-- Accuracy = 0.7724550898203593
#-- Balanced Accuracy = 0.7724550898203593
#-- Sensitivity = 0.7320359281437125
#-- Specificity = 0.812874251497006
#-- AUC-ROC = 0.8336452095808383
Compare these performance data with those from section 8-(2) (for the training set). When the default values were used, the DT model gave >0.99 for all performance measures, but the current models (developed using hyperparameter optimization) have much lower values, ranging from 0.73 to 0.83. Again, however, what really matters is the performance against the test set, which contains the data not used for model training.
y_true, y_pred = y_test, clf.predict(X_test) #-- Apply the model to predict the test set compounds' activity.
CMat = confusion_matrix( y_true, y_pred ) #-- generate confusion matrix
print(CMat) # [[TN, FP],
# [FN, TP]]
[[457 149]
[ 26 48]]
acc = accuracy_score( y_true, y_pred )
sens = CMat[ 1 ][ 1 ] / ( CMat[ 1 ][ 0 ] + CMat[ 1 ][ 1 ] )
spec = CMat[ 0 ][ 0 ] / ( CMat[ 0 ][ 0 ] + CMat[ 0 ][ 1 ] )
bacc = (sens + spec) / 2
y_score = clf.predict_proba( X_test )[:, 1]
auc = roc_auc_score( y_true, y_score )
print("#-- Accuracy = ", acc)
print("#-- Balanced Accuracy = ", bacc)
print("#-- Sensitivity = ", sens)
print("#-- Specificity = ", spec)
print("#-- AUC-ROC = ", auc)
#-- Accuracy = 0.7426470588235294
#-- Balanced Accuracy = 0.7013870305949514
#-- Sensitivity = 0.6486486486486487
#-- Specificity = 0.7541254125412541
#-- AUC-ROC = 0.7496209080367496
Now we can see that the model from hyperparameter optimization gives better performance data against the test set, compared to the model developed using the default parameter values. Importantly, the model from hyperparameter optimization shows smaller differences in performance measures between the training and test sets, indicatiing that the issue of outffiting has been alleviated substantially.
10. Exercises#
In this assignment, we will build predictive models using the same aromatase data.
step 1 Show the following information to make sure that the activity data in the df_activity data frame is still available.
The first five lines of df_activity
# Write your code in this cell.
df_activity.head(5)
| cid | activity | |
|---|---|---|
| 3 | 12850184.0 | 0 |
| 4 | 89753.0 | 0 |
| 5 | 9403.0 | 0 |
| 6 | 13218779.0 | 0 |
| 12 | 637566.0 | 0 |
The counts of active/inactive compounds in df_activity
# Write your code in this cell.
df_activity.groupby('activity').count()
| cid | |
|---|---|
| activity | |
| 0 | 6056 |
| 1 | 742 |
Step 2 Show the following information to make sure the structure data is still available.
The first five lines of df_smiles
# Write your code in this cell.
df_smiles.head(5)
| cid | smiles | |
|---|---|---|
| 0 | 12850184 | C(C(=O)[C@H]([C@@H]([C@H](C(=O)[O-])O)O)O)O.C(... |
| 1 | 89753 | C([C@H]([C@H]([C@@H]([C@H](C(=O)[O-])O)O)O)O)O... |
| 2 | 9403 | C[C@]12CC[C@H]3[C@H]([C@@H]1CC[C@@H]2OC(=O)CCC... |
| 3 | 13218779 | C[C@@]12CC[C@@H](C1(C)C)C[C@H]2OC(=O)CSC#N |
| 4 | 637566 | CC(=CCC/C(=C/CO)/C)C |
the number of rows of df_smiles
# Write your code in this cell.
len(df_smiles)
6798
Step 3 Generate the (ECFP-equivalent) circular fingerprints from the SMILES strings.
Use RDKit to generate 1024-bit-long circular fingerprints.
Set the radius of the circular fingerprint to 2.
Store the fingerprints in a data_frame called df_fps (along with the CIDs).
Print the dimension of df_fps.
Show the first five lines of df_fps.
# Write your code in this cell
from rdkit.Chem import AllChem
fps=dict()
for idx, row in df_smiles.iterrows() :
mol = Chem.MolFromSmiles(row.smiles)
if mol == None :
print("Can't generate MOL object:", "CID", row.cid, row.smiles)
else:
fps[row.cid] = [row.cid] + list(AllChem.GetMorganFingerprintAsBitVect(mol, 2, nBits=1024).ToBitString())
# Generate column names
fpbitnames = []
fpbitnames.append('cid')
for i in range(0,1024): # from MACCS000 to MACCS166
fpbitnames.append( "ecfp" + str(i).zfill(3) )
df_fps = pd.DataFrame.from_dict(fps, orient='index', columns=fpbitnames)
print(df_fps.shape)
df_fps.head(5)
Can't generate MOL object: CID 28145 [NH4+].[NH4+].F[Si-2](F)(F)(F)(F)F
Can't generate MOL object: CID 28127 F[Si-2](F)(F)(F)(F)F.[Na+].[Na+]
(6796, 1025)
| cid | ecfp000 | ecfp001 | ecfp002 | ecfp003 | ecfp004 | ecfp005 | ecfp006 | ecfp007 | ecfp008 | ... | ecfp1014 | ecfp1015 | ecfp1016 | ecfp1017 | ecfp1018 | ecfp1019 | ecfp1020 | ecfp1021 | ecfp1022 | ecfp1023 | |
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
| 12850184 | 12850184 | 0 | 1 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | ... | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 |
| 89753 | 89753 | 0 | 1 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | ... | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 |
| 9403 | 9403 | 0 | 0 | 0 | 1 | 1 | 0 | 0 | 0 | 0 | ... | 0 | 0 | 0 | 0 | 0 | 1 | 0 | 0 | 0 | 0 |
| 13218779 | 13218779 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | ... | 0 | 0 | 0 | 0 | 0 | 1 | 0 | 0 | 0 | 0 |
| 637566 | 637566 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | ... | 0 | 0 | 0 | 1 | 0 | 0 | 0 | 0 | 0 | 0 |
5 rows × 1025 columns
Step 4 Merge the df_activity and df_fps data frames into a data frame called df_data
Join the two data frames using the CID column as keys.
Remove the rows that have any NULL values (i.e., compounds for which the fingerprints couldn’t be generated).
Print the dimension of df_data.
Show the first five lines of df_data.
# Write your code in this cell.
df_data = df_activity.join(df_fps.set_index('cid'), on='cid')
df_data = df_data.dropna()
print(df_data.shape)
df_data.head(5)
(6796, 1026)
| cid | activity | ecfp000 | ecfp001 | ecfp002 | ecfp003 | ecfp004 | ecfp005 | ecfp006 | ecfp007 | ... | ecfp1014 | ecfp1015 | ecfp1016 | ecfp1017 | ecfp1018 | ecfp1019 | ecfp1020 | ecfp1021 | ecfp1022 | ecfp1023 | |
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
| 3 | 12850184.0 | 0 | 0 | 1 | 0 | 0 | 0 | 0 | 0 | 0 | ... | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 |
| 4 | 89753.0 | 0 | 0 | 1 | 0 | 0 | 0 | 0 | 0 | 0 | ... | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 |
| 5 | 9403.0 | 0 | 0 | 0 | 0 | 1 | 1 | 0 | 0 | 0 | ... | 0 | 0 | 0 | 0 | 0 | 1 | 0 | 0 | 0 | 0 |
| 6 | 13218779.0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | ... | 0 | 0 | 0 | 0 | 0 | 1 | 0 | 0 | 0 | 0 |
| 12 | 637566.0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | ... | 0 | 0 | 0 | 1 | 0 | 0 | 0 | 0 | 0 | 0 |
5 rows × 1026 columns
Step 5 Prepare input and output data for model building
Load the fingerprint data into 2-D array (X) and the activity data into 1-D array (y).
Show the dimension of X and y.
# Write your code in this cell.
X = df_data.iloc[:,2:]
y = df_data['activity'].values
print(X.shape)
print(len(y))
(6796, 1024)
6796
Remove zero-variance features from X (if any).
# Write your code in this cell.
sel = VarianceThreshold()
X=sel.fit_transform(X)
X.shape #-- dimension after removal (none removed)
(6796, 1024)
Split the data set into training and test sets (90% vs 10%) (using random_state=3100).
Print the dimension of X and y for the training and test sets.
# Write your code in this cell.
from sklearn.model_selection import train_test_split
X_train, X_test, y_train, y_test = \
train_test_split(X, y, shuffle=True, random_state=3100, stratify=y, test_size=0.1)
print(X_train.shape, X_test.shape, y_train.shape, y_test.shape)
print(y_train.sum(), y_test.sum())
print(len(y_train))
print(len(X_train))
print(len(X_train[0]))
(6116, 1024) (680, 1024) (6116,) (680,)
668 74
6116
6116
1024
Balance the training data set through downsampling.
Show the number of inactive/active compounds in the downsampled training set.
# Write your code in this cell.
# Indicies of each class' observations
idx_inactives = np.where( y_train == 0 )[0]
idx_actives = np.where( y_train == 1 )[0]
print(len(idx_inactives), len(idx_actives))
# Number of observations in each class
num_inactives = len(idx_inactives)
num_actives = len(idx_actives)
# Randomly sample from inactives without replacement
np.random.seed(0)
idx_inactives_downsampled = np.random.choice(idx_inactives, size=num_actives, replace=False)
# Join together downsampled inactives with actives
X_train = np.vstack((X_train[idx_inactives_downsampled], X_train[idx_actives]))
y_train = np.hstack((y_train[idx_inactives_downsampled], y_train[idx_actives]))
print("# inactives : ", len(y_train) - y_train.sum())
print("# actives : ", y_train.sum())
5448 668
# inactives : 668
# actives : 668
Step 6 Building a Random Forest model using the balanced training data set.
First read the followng documents about random forest (https://scikit-learn.org/stable/modules/ensemble.html#forest and https://scikit-learn.org/stable/modules/generated/sklearn.ensemble.RandomForestClassifier.html#sklearn.ensemble.RandomForestClassifier).
Use 10-fold cross validation to select the best value for the “n_estimators” parameter that maximizes the balanced accuracy. Test 40 values from 5 to 200 with an increment of 5 (e.g., 5, 10, 15, 20, …, 190, 195, 200).
For parameters ‘max_depth’, ‘min_samples_leaf’, and ‘min_samples_split’, use the best values found in Section 9.
For other parameters, use the default values.
For each parameter value, print the mean balanced accuracies (for both training and test from cross validation).
# Write your code in this cell.
from sklearn.ensemble import RandomForestClassifier
ncvs = 10
scores = ['roc_auc', 'balanced_accuracy']
n_estimators_range = np.linspace( 5, 200, num=40, dtype='int32' );
param_grid = dict( n_estimators=n_estimators_range );
clf = GridSearchCV( RandomForestClassifier( random_state=0, max_depth=5, min_samples_leaf=4, min_samples_split=3 ),
param_grid=param_grid, cv=ncvs, scoring=scores, refit='balanced_accuracy',
return_train_score = True, iid=False)
clf.fit( X_train, y_train )
print("#-- Best parameter set", clf.best_params_)
means_1a = clf.cv_results_['mean_train_balanced_accuracy']
means_1b = clf.cv_results_['mean_test_balanced_accuracy']
iterobjs = zip( means_1a, means_1b, clf.cv_results_['params'] )
for m1a, m1b, params in iterobjs :
print( "Grid %r : %0.4f %0.04f" % ( params, m1a, m1b))
#-- Best parameter set {'n_estimators': 100}
Grid {'n_estimators': 5} : 0.6801 0.6287
Grid {'n_estimators': 10} : 0.7236 0.6639
Grid {'n_estimators': 15} : 0.7388 0.6804
Grid {'n_estimators': 20} : 0.7512 0.6879
Grid {'n_estimators': 25} : 0.7542 0.6856
Grid {'n_estimators': 30} : 0.7571 0.6803
Grid {'n_estimators': 35} : 0.7616 0.6819
Grid {'n_estimators': 40} : 0.7596 0.6871
Grid {'n_estimators': 45} : 0.7586 0.6916
Grid {'n_estimators': 50} : 0.7621 0.6893
Grid {'n_estimators': 55} : 0.7663 0.6886
Grid {'n_estimators': 60} : 0.7651 0.6901
Grid {'n_estimators': 65} : 0.7669 0.6946
Grid {'n_estimators': 70} : 0.7646 0.6931
Grid {'n_estimators': 75} : 0.7653 0.6901
Grid {'n_estimators': 80} : 0.7659 0.6916
Grid {'n_estimators': 85} : 0.7644 0.6984
Grid {'n_estimators': 90} : 0.7661 0.6976
Grid {'n_estimators': 95} : 0.7642 0.7006
Grid {'n_estimators': 100} : 0.7666 0.7014
Grid {'n_estimators': 105} : 0.7662 0.6939
Grid {'n_estimators': 110} : 0.7682 0.6924
Grid {'n_estimators': 115} : 0.7697 0.6894
Grid {'n_estimators': 120} : 0.7708 0.6954
Grid {'n_estimators': 125} : 0.7699 0.6954
Grid {'n_estimators': 130} : 0.7695 0.6954
Grid {'n_estimators': 135} : 0.7702 0.6954
Grid {'n_estimators': 140} : 0.7718 0.6969
Grid {'n_estimators': 145} : 0.7713 0.6969
Grid {'n_estimators': 150} : 0.7706 0.6946
Grid {'n_estimators': 155} : 0.7720 0.6961
Grid {'n_estimators': 160} : 0.7720 0.6984
Grid {'n_estimators': 165} : 0.7714 0.6976
Grid {'n_estimators': 170} : 0.7715 0.6969
Grid {'n_estimators': 175} : 0.7725 0.6991
Grid {'n_estimators': 180} : 0.7725 0.6999
Grid {'n_estimators': 185} : 0.7709 0.6946
Grid {'n_estimators': 190} : 0.7717 0.6976
Grid {'n_estimators': 195} : 0.7719 0.6984
Grid {'n_estimators': 200} : 0.7730 0.6969
Step 7 Apply the developed RF model to predict the activity of the training set compounds.
Report the confusion matrix.
Report the accuracy, balanced accurayc, sensitivity, specificity, and auc-roc.
# Write your code in this cell.
y_true, y_pred = y_train, clf.predict( X_train ) # Apply the model to predict the training compound's activity.
CMat = confusion_matrix( y_true, y_pred ) #-- generate confusion matrix
print(CMat) # [[TN, FP],
# [FN, TP]]
acc = accuracy_score( y_true, y_pred )
sens = CMat[ 1 ][ 1 ] / ( CMat[ 1 ][ 0 ] + CMat[ 1 ][ 1 ] ) # TP / (FN + TP)
spec = CMat[ 0 ][ 0 ] / ( CMat[ 0 ][ 0 ] + CMat[ 0 ][ 1 ] ) # TN / (TN + FP )
bacc = (sens + spec) / 2
y_score = clf.predict_proba( X_train )[:, 1]
auc = roc_auc_score( y_true, y_score )
print("#-- Accuracy = ", acc)
print("#-- Balanced Accuracy = ", bacc)
print("#-- Sensitivity = ", sens)
print("#-- Specificity = ", spec)
print("#-- AUC-ROC = ", auc)
[[573 95]
[204 464]]
#-- Accuracy = 0.7761976047904192
#-- Balanced Accuracy = 0.7761976047904191
#-- Sensitivity = 0.6946107784431138
#-- Specificity = 0.8577844311377245
#-- AUC-ROC = 0.8431695740256016
Step 8 Apply the developed RF model to predict the activity of the test set compounds.
Report the accuracy, balanced accurayc, sensitivity, specificity, and auc-roc.
# Write your code in this cell.
y_true, y_pred = y_test, clf.predict(X_test) #-- Apply the model to predict the test set compounds' activity.
CMat = confusion_matrix( y_true, y_pred ) #-- generate confusion matrix
print(CMat) # [[TN, FP],
# [FN, TP]]
acc = accuracy_score( y_true, y_pred )
sens = CMat[ 1 ][ 1 ] / ( CMat[ 1 ][ 0 ] + CMat[ 1 ][ 1 ] )
spec = CMat[ 0 ][ 0 ] / ( CMat[ 0 ][ 0 ] + CMat[ 0 ][ 1 ] )
bacc = (sens + spec) / 2
y_score = clf.predict_proba( X_test )[:, 1]
auc = roc_auc_score( y_true, y_score )
print("#-- Accuracy = ", acc)
print("#-- Balanced Accuracy = ", bacc)
print("#-- Sensitivity = ", sens)
print("#-- Specificity = ", spec)
print("#-- AUC-ROC = ", auc)
[[484 122]
[ 28 46]]
#-- Accuracy = 0.7794117647058824
#-- Balanced Accuracy = 0.7101507448042101
#-- Sensitivity = 0.6216216216216216
#-- Specificity = 0.7986798679867987
#-- AUC-ROC = 0.7588975113727588
Step 9 Read a recent paper published in Chem. Res. Toxicol. (https://doi.org/10.1021/acs.chemrestox.7b00037) and answer the following questions (in no more than five sentences for each question).
What different approaches did the paper take to develop prediction models (compared to those used in this notebook)?
How different are the models reported in the paper from those constructed in this paper (in terms of the performance measures)?
What would you do to develop models with improved performance?
Write your answers in this cell.